CymitQuimica logo

CAS 553643-51-9

:

a-(Fmoc-amino)tetrahydro-2H-pyran-4-acetic acid

Description:
The chemical substance known as a-(Fmoc-amino)tetrahydro-2H-pyran-4-acetic acid, with the CAS number 553643-51-9, is a derivative of tetrahydropyran and is characterized by the presence of a Fmoc (9-fluorenylmethoxycarbonyl) protecting group attached to an amino group. This compound typically exhibits properties associated with both amino acids and cyclic structures, making it relevant in peptide synthesis and drug development. The Fmoc group serves as a protective moiety that can be removed under mild basic conditions, allowing for selective deprotection during synthetic procedures. The tetrahydropyran ring contributes to the compound's stability and solubility in organic solvents. Additionally, the acetic acid moiety provides acidic characteristics, which can influence the compound's reactivity and interactions in biological systems. Overall, this compound is significant in the field of organic chemistry and medicinal chemistry, particularly in the synthesis of complex molecules and as a building block in peptide synthesis.
Formula:C22H23NO5
InChI:InChI=1S/C22H23NO5/c24-21(25)20(14-9-11-27-12-10-14)23-22(26)28-13-19-17-7-3-1-5-15(17)16-6-2-4-8-18(16)19/h1-8,14,19-20H,9-13H2,(H,23,26)(H,24,25)
InChI key:WNRMJMFKNFPDFJ-UHFFFAOYSA-N
SMILES:C1COCCC1C(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24
Synonyms:
  • 2H-Pyran-4-acetic acid, α-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]tetrahydro-
  • a-(Fmoc-amino)tetrahydro-2H-pyran-4-acetic acid
  • 2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-2-(tetrahydro-2H-pyran-4-yl)acetic acid
Found 3 products.