CAS 554-62-1: Phytosphingosine
Description:Phytosphingosine is a naturally occurring sphingolipid, characterized by its long-chain amino alcohol structure. It plays a crucial role in cellular signaling and is a key component of the lipid bilayer in cell membranes, particularly in skin cells. Phytosphingosine is known for its bioactive properties, including antimicrobial, anti-inflammatory, and skin barrier-enhancing effects, making it valuable in cosmetic and dermatological formulations. The substance is typically found in various plant sources, particularly in certain types of yeast and in the skin of mammals. Its chemical structure includes a sphingoid base with a hydroxyl group, which contributes to its hydrophilic and hydrophobic characteristics, allowing it to interact effectively with both lipids and proteins. Phytosphingosine is also recognized for its potential therapeutic applications, including its role in skin health and its ability to modulate cellular processes. Due to its beneficial properties, it is often incorporated into skincare products aimed at improving skin hydration and barrier function.
Formula:C18H39NO3
InChI:InChI=1S/C18H39NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17(21)18(22)16(19)15-20/h16-18,20-22H,2-15,19H2,1H3/t16-,17+,18-/m0/s1
InChI key:InChIKey=AERBNCYCJBRYDG-KSZLIROESA-N
SMILES:OCC(N)C(O)C(O)CCCCCCCCCCCCCC
- Synonyms:
- 1,3,4-Octadecanetriol, 2-amino-, (2S,3S,4R)-
- (2S,3S,4R)-2-Amino-1,3,4-octadecanetriol
- 1,3,4-Octadecanetriol, 2-amino-, [2S-(2R*,3R*,4S*)]-
- Phytosphingosine
- 1,3,4-Octadecanetriol, 2-amino-, D-ribo-
