CymitQuimica logo

CAS 55403-29-7

:

6-(piperidin-1-yl)pyridin-3-amine

Description:
6-(Piperidin-1-yl)pyridin-3-amine, with the CAS number 55403-29-7, is a chemical compound characterized by its pyridine and piperidine functional groups. This compound features a pyridine ring substituted at the 3-position with an amino group and at the 6-position with a piperidine moiety, which contributes to its potential biological activity. The presence of the piperidine ring enhances its lipophilicity and may influence its ability to interact with biological targets, making it of interest in medicinal chemistry. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents. Its structure suggests potential applications in drug development, particularly in the fields of neuropharmacology and as a scaffold for synthesizing more complex molecules. Additionally, the presence of both nitrogen-containing rings may impart unique electronic properties, influencing reactivity and binding interactions in biological systems. As with many amines, it may also exhibit basicity, allowing it to participate in various chemical reactions.
Formula:C10H15N3
InChI:InChI=1/C10H15N3/c11-9-4-5-10(12-8-9)13-6-2-1-3-7-13/h4-5,8H,1-3,6-7,11H2
InChI key:WONYQZCHGNGJRW-UHFFFAOYSA-N
SMILES:C1CCN(CC1)c1ccc(cn1)N
Synonyms:
  • 3-Pyridinamine, 6-(1-Piperidinyl)-
  • 6-Piperidin-1-Ylpyridin-3-Amine
Found 4 products.