CymitQuimica logo

CAS 55484-53-2

:

1H-Isoindole-1,3(2H)-dione, 2-[(1-oxo-2-propenyl)oxy]-

Description:
1H-Isoindole-1,3(2H)-dione, 2-[(1-oxo-2-propenyl)oxy]- is a chemical compound characterized by its isoindole structure, which features a bicyclic system consisting of a five-membered ring fused to a six-membered ring. This compound contains a dione functional group, indicating the presence of two carbonyl (C=O) groups, which contribute to its reactivity and potential applications in organic synthesis. The presence of a propenyl ether moiety suggests that it may participate in various chemical reactions, including nucleophilic substitutions and polymerization processes. The compound's molecular structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry. Its CAS number, 55484-53-2, serves as a unique identifier for regulatory and research purposes. Overall, this compound's unique structural features and functional groups may provide avenues for further exploration in both synthetic and pharmaceutical chemistry.
Formula:C11H7NO4
InChI:InChI=1S/C11H7NO4/c1-2-9(13)16-12-10(14)7-5-3-4-6-8(7)11(12)15/h2-6H,1H2
InChI key:YOVNLDXKLKJVIV-UHFFFAOYSA-N
SMILES:C=CC(=O)ON1C(=O)C2=CC=CC=C2C1=O
Found 4 products.