CAS 555-92-0
:Piperidine, 2-propyl-, hydrochloride (1:1), (2S)-
Description:
Piperidine, 2-propyl-, hydrochloride (1:1), (2S)-, with the CAS number 555-92-0, is a chemical compound that belongs to the class of piperidine derivatives. It is characterized by a piperidine ring, which is a six-membered saturated heterocyclic compound containing one nitrogen atom. The "2-propyl" designation indicates that a propyl group is attached to the second carbon of the piperidine ring, while the "(2S)-" notation refers to the specific stereochemistry of the molecule, indicating that it has a particular spatial arrangement of its atoms. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its stability and solubility in water. This compound may exhibit biological activity and is of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its properties, such as melting point, solubility, and reactivity, can vary based on the specific conditions and the presence of other substances. Safety data should be consulted for handling and usage guidelines.
Formula:C8H17N·ClH
InChI:InChI=1S/C8H17N.ClH/c1-2-5-8-6-3-4-7-9-8;/h8-9H,2-7H2,1H3;1H/t8-;/m0./s1
InChI key:InChIKey=JXBWZNQZRWZJIR-QRPNPIFTSA-N
SMILES:C(CC)[C@H]1CCCCN1.Cl
Synonyms:- (2R)-2-propylpiperidine
- (S)-(+)-Coniine hydrochloride
- (S)-2-Propylpiperidine hydrochloride
- Coniin hydrochloride
- Coniine HCl
- Nsc 15128
- Piperidine, 2-propyl-, hydrochloride (1:1), (2S)-
- Piperidine, 2-propyl-, hydrochloride, (2S)-
- Piperidine, 2-propyl-, hydrochloride, (S)-
- Piperidine, 2-propyl-, hydrochloride, (S)- (9CI)
- Unii-3H575Mz6Vn
- (+)-Coniine hydrochloride
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(S)-2-Propylpiperidine hydrochloride
CAS:(S)-2-Propylpiperidine hydrochlorideFormula:C8H17N·ClHPurity:97%Molecular weight:163.68822(+/-)-2-PROPYLPIPERIDINE HYDROCHLORIDE
CAS:Formula:C8H18ClNPurity:97%Color and Shape:SolidMolecular weight:163.6882(S)-2-Propylpiperidine hydrochloride
CAS:(S)-2-Propylpiperidine hydrochlorideFormula:C11H14O3Purity:97%Molecular weight:163.69DL-ConiineHydrochloride
CAS:DL-Coniine Hydrochloride is a synthetic alkaloid, which is derived from the plant Conium maculatum, commonly known as hemlock. Coniine acts primarily as a nicotinic acetylcholine receptor antagonist, meaning it blocks the normal action of acetylcholine on these receptors in the nervous system, leading to muscle paralysis. Its mode of action involves the inhibition of synaptic transmission at the neuromuscular junction, disrupting normal neurological communication.Formula:C8H18ClNPurity:Min. 95%Molecular weight:163.69 g/mol




