CymitQuimica logo

CAS 55514-25-5

:

1-Octanol, 2,4-diethyl-

Description:
1-Octanol, 2,4-diethyl- is an organic compound characterized by its long hydrocarbon chain and the presence of two ethyl groups attached to the second and fourth carbon atoms of the octanol backbone. This compound belongs to the class of alcohols, specifically fatty alcohols, which are known for their hydrophobic properties due to the long alkyl chain. It typically exhibits a colorless to pale yellow liquid appearance and has a relatively high boiling point compared to shorter-chain alcohols, reflecting its larger molecular size. The presence of the hydroxyl (-OH) functional group imparts some polar characteristics, allowing for limited solubility in water while being more soluble in organic solvents. 1-Octanol, 2,4-diethyl- is often used in various applications, including as a solvent, in the formulation of surfactants, and in the production of fragrances and flavoring agents. Its chemical behavior is influenced by both the alcohol functional group and the hydrophobic alkyl chains, making it a compound of interest in both industrial and research settings.
Formula:C12H26O
InChI:InChI=1S/C12H26O/c1-4-7-8-11(5-2)9-12(6-3)10-13/h11-13H,4-10H2,1-3H3
InChI key:HBOTYIBMGKDGNK-UHFFFAOYSA-N
SMILES:CCCCC(CC)CC(CC)CO
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.