CymitQuimica logo

CAS 556109-99-0

:

(2-morpholin-4-ylpyridin-4-yl)methanol

Description:
(2-Morpholin-4-ylpyridin-4-yl)methanol, with the CAS number 556109-99-0, is a chemical compound characterized by its unique structure, which includes a morpholine ring and a pyridine moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of hydroxyl (-OH) and nitrogen-containing functional groups. The morpholine ring contributes to its basicity and potential for hydrogen bonding, while the pyridine component may impart aromatic characteristics and influence its electronic properties. This compound may be of interest in medicinal chemistry, particularly for its potential biological activity, as derivatives of morpholine and pyridine are often explored for their pharmacological properties. Additionally, its synthesis and reactivity can be influenced by the functional groups present, making it a candidate for further chemical modifications. Overall, (2-morpholin-4-ylpyridin-4-yl)methanol represents a versatile structure with implications in various fields, including drug development and organic synthesis.
Formula:C10H14N2O2
InChI:InChI=1/C10H14N2O2/c13-8-9-1-2-11-10(7-9)12-3-5-14-6-4-12/h1-2,7,13H,3-6,8H2
InChI key:ODPRUQYSXQSWQA-UHFFFAOYSA-N
SMILES:c1cnc(cc1CO)N1CCOCC1
Synonyms:
  • (2-Morpholinopyrid-4-Yl)Methanol
Found 4 products.