CymitQuimica logo

CAS 55676-22-7

:

1-(6-chloro-3-pyridinyl)-1-ethanone

Description:
1-(6-Chloro-3-pyridinyl)-1-ethanone, with the CAS number 55676-22-7, is a chemical compound characterized by its pyridine ring and an ethanone functional group. This compound features a chlorine atom substituted at the 6-position of the pyridine ring, which contributes to its unique chemical properties. The presence of the carbonyl group (C=O) in the ethanone structure indicates that it can participate in various chemical reactions, such as nucleophilic additions. The chlorinated pyridine moiety may enhance the compound's reactivity and influence its biological activity, making it of interest in medicinal chemistry and agrochemical applications. Additionally, the compound's molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. Its solubility and stability in different solvents can vary, depending on the specific conditions, and it may exhibit distinct physical properties such as melting and boiling points. Overall, this compound represents a class of heterocyclic compounds that are significant in various chemical and pharmaceutical research fields.
Formula:C7H6ClNO
InChI:InChI=1S/C7H6ClNO/c1-5(10)6-2-3-7(8)9-4-6/h2-4H,1H3
InChI key:UXSNZYGTQTXRAD-UHFFFAOYSA-N
SMILES:CC(=O)C1=CN=C(C=C1)Cl
Synonyms:
  • 2-Chloro-5-acetylpyridine
  • 1-(6-Chloropyridin-3-Yl)Ethanone
  • 5-Acetyl-2-chloropyridine1-(6-Chloro-3-pyridinyl)-1-ethanone
  • 3-Acetyl-6-chloropyridine
Found 5 products.