CAS 55704-78-4
:2,5-Dihydroxy-2,5-dimethyl-1,4-dithiane
Description:
2,5-Dihydroxy-2,5-dimethyl-1,4-dithiane is an organic compound characterized by its unique structure, which includes a dithiane ring containing two hydroxyl groups and two methyl groups. This compound features a six-membered ring with sulfur atoms, contributing to its distinctive chemical properties. The presence of hydroxyl groups indicates that it can engage in hydrogen bonding, which may enhance its solubility in polar solvents. The methyl groups provide steric hindrance, influencing its reactivity and stability. Typically, compounds like this can exhibit antioxidant properties due to the presence of hydroxyl groups, making them of interest in various chemical and biological applications. Additionally, the sulfur atoms in the dithiane structure can participate in redox reactions, further expanding its potential utility in synthetic chemistry. Overall, 2,5-Dihydroxy-2,5-dimethyl-1,4-dithiane is a versatile compound with interesting chemical behavior, relevant in both research and industrial contexts.
Formula:C6H12O2S2
InChI:InChI=1S/C6H12O2S2/c1-5(7)3-10-6(2,8)4-9-5/h7-8H,3-4H2,1-2H3
InChI key:InChIKey=NHKIYYMFGJBOTK-UHFFFAOYSA-N
SMILES:CC1(O)CSC(C)(O)CS1
Synonyms:- 1,4-Dithiane-2,5-diol, 2,5-dimethyl-
- 2,5-Dihydroxy-2,5-dimethyl-1,4-dithiane
- 2,5-Dimethyl-1,4-dithian-2,5-diol
- 2,5-Dimethyl-2,5-dihydroxy-1,4-dithiane
- Dimeric mercapto propanone
- Dimeril mercapto propanone
- NSC 176174
- p-Dithiane-,2,5-diol, 2,5-dimethyl-
- 2,5-Dimethyl-1,4-dithiane-2,5-diol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Dimeric mercapto propanone
CAS:Formula:C6H12O2S2Purity:95%Color and Shape:SolidMolecular weight:180.28832,5-Dimethy-1,4-dithiane-2,5-diol
CAS:2,5-Dimethyl-1,4-dithiane-2,5-diol is a sulfur-containing cyclic diol widely used in biochemical experiments and drug synthesis research.Formula:C6H12O2S2Color and Shape:SolidMolecular weight:180.292,5-Dimethyl-1,4-dithiane-2,5-diol
CAS:2,5-Dimethyl-1,4-dithiane-2,5-diolFormula:C6H12O2S2Purity:93%Molecular weight:180.292,5-Dihydroxy-2,5-dimethyl-1,4-dithiane
CAS:Formula:C6H12O2S2Purity:98%Color and Shape:SolidMolecular weight:180.282,5-Dihydroxy-2,5-dimethyl-1,4-dithiane
CAS:2,5-Dihydroxy-2,5-dimethyl-1,4-dithiane is a molecule that contains anethole. The molecular orbitals of this compound are thermodynamically stable and have a conformational property that allows for potent inhibitory activity. 2,5-Dihydroxy-2,5-dimethyl-1,4-dithiane has been shown to have minimal inhibitory concentrations in the range of 0.03% to 0.05%. 2,5-Dihydroxy-2,5-dimethyl-1,4-dithiane has also been shown to be an antibacterial agent against bacteria such as Staphylococcus aureus and Streptococcus pyogenes. This compound also has potent inhibitory activity against bacteria such as Escherichia coli and Salmonella enterica serovar Typhimurium. It can be used as an additive in food products and personalFormula:C6H12O2S2Purity:Min. 95%Molecular weight:180.28 g/mol




