CAS 55717-54-9
:N-Acetyl-9-O-acetylneuraminic acid
Description:
N-Acetyl-9-O-acetylneuraminic acid, commonly referred to as Neu5Ac, is a sialic acid derivative characterized by its acetylated functional groups. This compound is a key component of glycoproteins and glycolipids, playing a crucial role in cellular recognition processes, particularly in the context of viral infections and immune responses. It features a nine-carbon backbone with an acetamido group and an additional acetyl group at the 9-position, which enhances its stability and solubility in biological systems. The presence of these acetyl groups contributes to its biological activity, influencing interactions with lectins and other proteins. N-Acetyl-9-O-acetylneuraminic acid is often studied for its implications in virology, particularly regarding influenza viruses, as it can affect viral binding and entry into host cells. Additionally, its structural properties make it a subject of interest in the development of therapeutic agents and vaccines. Overall, this compound exemplifies the complexity and significance of sialic acids in biochemistry and molecular biology.
Formula:C13H21NO10
InChI:InChI=1S/C13H21NO10/c1-5(15)14-10(7(17)3-8(18)13(22)23)12(21)11(20)9(19)4-24-6(2)16/h7,9-12,17,19-21H,3-4H2,1-2H3,(H,14,15)(H,22,23)/t7-,9+,10+,11+,12+/m0/s1
InChI key:InChIKey=HFRNAEAHYNBJEW-FRNCOOQWSA-N
SMILES:[C@H]([C@H]([C@@H]([C@@H](COC(C)=O)O)O)O)([C@H](CC(C(O)=O)=O)O)NC(C)=O
Synonyms:- N-Acetyl-9-O-acetylneuraminic acid
- N,9-O-Diacetylneuraminic acid
- Neuraminic acid, N-acetyl-, 9-acetate
- D-glycero-D-galacto-2-Nonulosonic acid, 5-(acetylamino)-3,5-dideoxy-, 9-acetate
- 9-O-Acetyl-N-acetylneuraminic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
N-Acetyl-9-O-acetylneuraminic Acid
CAS:Formula:C13H21NO10Purity:>75.0%(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:351.319-acetate N-acetyl-neuraminic acid
CAS:Formula:C13H21NO10Purity:98%Color and Shape:SolidMolecular weight:351.3065(2S,4S,5R,6R)-5-acetamido-6-((1R,2R)-3-acetoxy-1,2-dihydroxypropyl)-2,4-dihydroxytetrahydro-2H-pyran-2-carboxylic acid
CAS:(2S,4S,5R,6R)-5-acetamido-6-((1R,2R)-3-acetoxy-1,2-dihydroxypropyl)-2,4-dihydroxytetrahydro-2H-pyran-2-carboxylic acidPurity:≥95%Molecular weight:351.31g/mol9-O-Acetyl-N-acetyl-neuraminic acid
CAS:9-O-Acetyl-N-acetyl-neuraminic acid is a sialic acid produced by the human body. It can be found in human serum and has been shown to have inhibitory properties against viruses, such as hepatitis B and C viruses. 9-O-Acetyl-N-acetylneuraminic acid binds to the α1-acid glycoprotein in the blood, which can reduce its ability to bind to other molecules. This leads to a lower concentration of 9-O-acetylneuraminic acid in the blood. This molecule also has chemical biology properties that are being studied for their effects on biological processes such as histological analysis, receptor molecule binding, polymerase chain reaction (PCR), and mucin gene transcription. 9-O-Acetylneuraminic acid also has antihistamine activities that may be due to its ability to block histamine receptors or inhibit histamine release.Formula:C13H21NO10Purity:Min. 75 Area-%Color and Shape:White Off-White PowderMolecular weight:351.31 g/molN,9-O-Diacetylneuraminic Acid
CAS:Controlled ProductApplications N,9-O-Diacetylneuraminic Acid is a primary receptor determinant of influenza C virus.
References Rogers, G., et al.: J. Biol. Chem., 261, 5947 (1986); Herrler, G., et al.: EMBO J., 4, 1503 (1985);Formula:C13H21NO10Color and Shape:NeatMolecular weight:351.31




