CAS 55745-83-0

2-(piperazin-1-yl)-1,3-benzothiazole

Description:

2-(Piperazin-1-yl)-1,3-benzothiazole is a chemical compound characterized by its unique structure, which includes a benzothiazole moiety fused with a piperazine ring. This compound typically exhibits properties such as moderate solubility in polar solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the piperazine group often contributes to its ability to interact with biological targets, potentially influencing its pharmacological properties. The benzothiazole component is known for its role in various biological activities, including antimicrobial and anticancer effects. Additionally, the compound may exhibit characteristics such as stability under standard laboratory conditions, though specific reactivity can depend on the functional groups present. Its molecular weight and specific physical properties, such as melting point and boiling point, can vary based on the purity and form of the compound. Overall, 2-(piperazin-1-yl)-1,3-benzothiazole represents a versatile scaffold in drug development, warranting further investigation into its therapeutic potential.

Formula: C₁₁H₁₃N₃S

InChI: InChI=1/C11H13N3S/c1-2-4-10-9(3-1)13-11(15-10)14-7-5-12-6-8-14/h1-4,12H,5-8H2

SMILES: c1ccc2c(c1)nc(N1CCNCC1)s2

Synonyms:

• 1-(Benzothiazol-2-yl)piperazine
• 2-(1-Piperazinyl)-1,3-benzothiazole
• Benzothiazole, 2-(1-piperazinyl)-

2-Piperazin-1-yl-benzothiazole

CAS: 55745-83-0

Formula: C₁₁H₁₃N₃S

Purity: 98%

Color and Shape: Solid

Molecular weight: 219.3060

Ref: IN-DA00D8D7

Lurasidone Impurity 35

CAS: 55745-83-0

Formula: C₁₁H₁₃N₃S

Color and Shape: White To Off-White Solid

Molecular weight: 219.31

Ref: 4Z-L-090047

2-Piperazin-1-yl-benzothiazole

CAS: 55745-83-0

Purity: 95.0%

Color and Shape: Liquid

Molecular weight: 219.30999755859375

Ref: 10-F029240

2-Piperazin-1-yl-1,3-benzothiazole

CAS: 55745-83-0

2-Piperazin-1-yl-1,3-benzothiazole

Purity: 99%

Molecular weight: 219.31g/mol

Ref: 54-OR0168

Lurasidone impurity 35

CAS: 55745-83-0

Formula: C₁₁H₁₃N₃S

Molecular weight: 219.31

Ref: ST-EA-CP-L4007

2-Piperazin-1-yl-benzothiazole

CAS: 55745-83-0

2-Piperazin-1-yl-benzothiazole is an agent that acts as a serotonin 5HT1a receptor agonist. The drug has been shown to be effective in the treatment of HIV infection. It was found that 2-piperazin-1-yl-benzothiazole inhibited transcriptional regulation by blocking the phosphorylation of the transcriptional regulator, CREB. This resulted in decreased expression of genes responsible for viral replication and increased expression of genes required for T cell activation. The drug is currently under investigation as a potential treatment for schizophrenia and Parkinson's disease. 2-Piperazin-1-yl-benzothiazole can also act as a silico probe. A study has shown that it binds to human dopamine D2 receptors and inhibits dopamine release from synaptosomes, leading to increased levels of dopamine in the brain. This may be due to its ability to bind to both dopamine D2 and serotonin

Formula: C₁₁H₁₃N₃S

Purity: Min. 95%

Molecular weight: 219.31 g/mol

Ref: 3D-FP50777