CAS 55750-06-6: Imidocarb dipropionate
Description:Imidocarb dipropionate is a chemical compound primarily used as an antiparasitic agent, particularly in veterinary medicine for the treatment of certain protozoal infections in animals, such as those caused by Babesia and Leptospira species. It is a member of the imidocarb family, characterized by its imidazole ring structure, which contributes to its biological activity. The compound is typically administered via injection and is known for its efficacy in controlling parasitic diseases. Imidocarb dipropionate is also recognized for its relatively low toxicity in mammals, making it a preferred choice in veterinary applications. Its mode of action involves the inhibition of nucleic acid synthesis in parasites, leading to their death. Additionally, the compound is stable under normal storage conditions but should be kept away from light and moisture to maintain its efficacy. As with any pharmaceutical agent, proper dosage and administration guidelines should be followed to minimize potential side effects and ensure the safety of the treated animals.
Formula:C19H20N6O·2C3H6O2
InChI:InChI=1S/C19H20N6O.C3H6O2/c26-19(24-15-5-1-3-13(11-15)17-20-7-8-21-17)25-16-6-2-4-14(12-16)18-22-9-10-23-18;1-2-3(4)5/h1-6,11-12H,7-10H2,(H,20,21)(H,22,23)(H2,24,25,26);2H2,1H3,(H,4,5)
InChI key:InChIKey=IRPJGGHUXQZOQW-UHFFFAOYSA-N
SMILES:O=C(O)CC.O=C(NC1=CC=CC(=C1)C2=NCCN2)NC3=CC=CC(=C3)C4=NCCN4
- Synonyms:
- Carbesia
- Imidocarb dipropionate
- Imidox
- Imizol
- Imizol (antiprotozoal)
- N,N-Bis[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]urea dipropanoate
- N,N-bis(3-(4,5-dihydro-1H-imidazol-2-yl)phenyl)urea) dipropionate
- Propanoic acid, compd. with N,N′-bis[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]urea (2:1)
- Urea, N,N′-bis[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-, dipropanoate
