CymitQuimica logo

CAS 55829-43-1

:

2-piperazin-1-ylacetamide

Description:
2-Piperazin-1-ylacetamide, with the CAS number 55829-43-1, is a chemical compound characterized by its piperazine ring structure, which is a six-membered ring containing two nitrogen atoms. This compound features an acetamide functional group, contributing to its properties as an amide. It is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, which is indicative of its ability to form hydrogen bonds due to the presence of the amide group. The piperazine moiety imparts basic characteristics, allowing it to interact with various biological targets, making it of interest in medicinal chemistry. Its potential applications may include roles as a pharmaceutical intermediate or in the development of therapeutic agents. As with many organic compounds, safety data should be consulted to understand its handling and toxicity, as well as its stability under various conditions. Overall, 2-piperazin-1-ylacetamide is a versatile compound with significant implications in chemical and pharmaceutical research.
Formula:C6H13N3O
InChI:InChI=1/C6H13N3O.2ClH.H2O/c7-6(10)5-9-3-1-8-2-4-9;;;/h8H,1-5H2,(H2,7,10);2*1H;1H2
InChI key:VNRJGEMERJZKLQ-UHFFFAOYSA-N
SMILES:C1CN(CCN1)CC(=N)O.Cl.Cl.O
Found 5 products.