CymitQuimica logo

CAS 55855-43-1

:

Ethanamine, 2-(diphenylmethoxy)-N-methyl-N-nitroso-

Description:
Ethanamine, 2-(diphenylmethoxy)-N-methyl-N-nitroso- is a chemical compound characterized by its amine functional group and the presence of a nitroso group, which contributes to its reactivity. The structure features a diphenylmethoxy group, indicating the presence of two phenyl rings attached to a methoxy group, which can influence its solubility and interaction with other molecules. This compound is typically classified as an organic nitrogen compound and may exhibit properties such as being a potential intermediate in organic synthesis or a reagent in various chemical reactions. The nitroso group can impart unique reactivity, making it of interest in studies related to nitrosamines, which are known for their biological activity and potential health implications. As with many nitrogen-containing compounds, it may also exhibit basicity due to the presence of the amine group. Safety and handling precautions are essential, as compounds with nitroso groups can be hazardous. Overall, this compound's specific characteristics, including its reactivity and potential applications, would depend on its detailed structural and electronic properties.
Formula:C16H18N2O2
InChI:InChI=1S/C16H18N2O2/c1-18(17-19)12-13-20-16(14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-11,16H,12-13H2,1H3
InChI key:AZLXCAYLZMGCFN-UHFFFAOYSA-N
SMILES:CN(CCOC(C1=CC=CC=C1)C2=CC=CC=C2)N=O
Synonyms:
  • Tenapanor Impurity 1
  • Ethanamine, 2-(diphenylmethoxy)-N-methyl-N-nitroso-
  • Diphenhydramine Impurity 5
  • N-Nitroso Diphenhydramine
  • N-Nitroso Diphenhydramine EP Impurity A
Found 9 products.