CAS 559-64-8

(3beta,5xi,6beta,9xi,18xi)-3,6-dihydroxyolean-12-en-28-oic acid

Description:

The chemical substance known as (3beta,5xi,6beta,9xi,18xi)-3,6-dihydroxyolean-12-en-28-oic acid, with the CAS number 559-64-8, is a naturally occurring triterpenoid compound. It is primarily derived from various plant sources, particularly those in the family of medicinal herbs. This compound exhibits a complex steroid-like structure characterized by multiple hydroxyl groups, which contribute to its biological activity. It is known for its potential pharmacological properties, including anti-inflammatory, antioxidant, and anticancer effects. The presence of hydroxyl groups enhances its solubility in polar solvents and may facilitate interactions with biological macromolecules. Additionally, this compound is often studied for its role in traditional medicine and its potential therapeutic applications. Its structural features, including the oleanane skeleton, are significant for its biological activity and interactions within various biochemical pathways. Overall, (3beta,5xi,6beta,9xi,18xi)-3,6-dihydroxyolean-12-en-28-oic acid represents a valuable subject of research in both chemistry and pharmacology.

Formula: C₃₀H₄₈O₄

InChI: InChI=1/C30H48O4/c1-25(2)12-14-30(24(33)34)15-13-28(6)18(19(30)16-25)8-9-21-27(5)11-10-22(32)26(3,4)23(27)20(31)17-29(21,28)7/h8,19-23,31-32H,9-17H2,1-7H3,(H,33,34)/t19?,20-,21?,22+,23?,27-,28-,29-,30+/m1/s1

InChI key: KLHSKTMVSOWVLD-WPDRYGPBSA-N

SMILES: C[C@]12CC[C@@H](C([C@@H]1[C@@H](C[C@@]3([C@@H]2CC=C4[C@]3(CC[C@@]5([C@H]4CC(CC5)(C)C)C(=O)O)C)C)O)(C)C)O

Sumaresinolic Acid

CAS: 559-64-8

Formula: C₃₀H₄₈O₄

Molecular weight: 472.6997

Ref: IN-DA00DONS

Sumaresinolic Acid

CAS: 559-64-8

Sumaresinolic Acid

Formula: C₃₀H₄₈O₄

Purity: ≥95%

Molecular weight: 472.71

Ref: 54-BUP07135

Sumaresinolic Acid

CAS: 559-64-8

Sumaresinolic Acid, a natural lignan in flaxseed, sesame, wheat bran, may reduce inflammation, improve lipids, and offer antioxidant benefits.

Formula: C₃₀H₄₈O₄

Purity: 98.86%

Color and Shape: Solid

Molecular weight: 472.7

Ref: TM-T8772

Sumaresinolic acid

Controlled Product

CAS: 559-64-8

Sumaresinolic acid is a naturally occurring triterpenoid compound, which is typically isolated from certain plant species, such as those belonging to the Sumac (Rhus) family. This compound is characterized by its complex molecular structure that endows it with various biochemical activities. Sumaresinolic acid acts primarily through anti-inflammatory and antioxidant pathways, influencing cellular signaling and modulating enzymatic activity related to inflammation and oxidative stress.

Formula: C₃₀H₄₈O₄

Purity: Min. 95 Area-%

Color and Shape: Powder

Molecular weight: 472.7 g/mol

Ref: 3D-FS57650