CAS 55921-65-8
:Triaminodil
Description:
Triaminodil, identified by its CAS number 55921-65-8, is a chemical compound that belongs to the class of organic compounds known as amines. It is characterized by the presence of three amine groups, which contribute to its reactivity and potential applications in various chemical processes. The compound typically exhibits properties such as solubility in polar solvents, which is common for amines, and may have a basic nature due to the presence of nitrogen atoms that can accept protons. Triaminodil is often studied for its potential use in pharmaceuticals, agrochemicals, and as a building block in organic synthesis. Its structure allows for various functional modifications, making it versatile in chemical reactions. Safety data and handling precautions should be considered, as with many amines, due to potential toxicity and reactivity. Overall, Triaminodil represents an interesting compound within the realm of organic chemistry, with implications for research and industrial applications.
Formula:C8H13N5O
InChI:InChI=1S/C8H13N5O/c9-6-5-7(11-8(10)13(6)14)12-3-1-2-4-12/h5H,1-4,9H2,(H2,10,11)
InChI key:InChIKey=FMVJDYVWXJHAFZ-UHFFFAOYSA-N
SMILES:NC1=CC(=NC(N)=N1=O)N2CCCC2
Synonyms:- 2,4-Diamino-6-pyrrolidinopyrimidine 3-oxide
- 2,4-Pyrimidinediamine, 6-(1-Pyrrolidinyl)-, 3-Oxide
- 2,6-Diamino-4-(pyrrolidin-1-yl)pyrimidine 1-oxide
- 6-Pyrrolidino-2,4-Diaminopyrimidine 3-Oxide
- Pyrrolidinyl Diaminopyrimidine Oxide
- Triaminodil
- 6-(Pyrrolidin-1-yl)pyrimidine-2,4-diamine 3-oxide
- Nanoxidil
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
6-(1-Pyrrolidinyl)-2,4-pyrimidinediamine 3-oxide
CAS:Formula:C8H13N5OPurity:97%Color and Shape:SolidMolecular weight:195.2217Pyrrolidinyl diaminopyrimidine oxide
CAS:Pyrrolidinyl diaminopyrimidine oxideFormula:C8H13N5OPurity:97%Molecular weight:195.222,6-Diamino-4-(pyrrolidin-1-yl)pyrimidine 1-Oxide
CAS:Formula:C8H13N5OPurity:>98.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:195.232,6-Diamino-4-(pyrrolidin-1-yl)pyrimidine 1-oxide
CAS:2,6-Diamino-4-(pyrrolidin-1-yl)pyrimidine 1-oxideFormula:C8H13N5OPurity:97%Molecular weight:195.224-Pyrrolidine 2,6-diaminopyrimidine 1-oxide
CAS:4-Pyrrolidine 2,6-diaminopyrimidine 1-oxide is a particle that is typically used as a dietary supplement. It is derived from the fruit extract of soybeans and usnic acid. This compound has been shown to stimulate hair growth in patients with alopecia areata by stimulating the production of growth factors. The active substances in 4-pyrrolidine 2,6-diaminopyrimidine 1-oxide can be found in damaged cells and are believed to stimulate cell regeneration. Its ability to increase the production of growth factors may also have cosmetic benefits such as reducing wrinkles or improving skin elasticity.Formula:C8H13N5OPurity:Min. 95%Color and Shape:PowderMolecular weight:195.22 g/mol2,6-DIAMINO-4-(PYRROLIDIN-1-YL)PYRIMIDINE 1-OXIDE
CAS:Formula:C8H13N5OPurity:97%Color and Shape:SolidMolecular weight:195.226





