CymitQuimica logo

CAS 55954-27-3

:

2,4-Dichlorobenzeneacetamide

Description:
2,4-Dichlorobenzeneacetamide, with the CAS number 55954-27-3, is an organic compound characterized by its structure, which features a benzene ring substituted with two chlorine atoms at the 2 and 4 positions, and an acetamide functional group. This compound is typically a white to off-white crystalline solid, exhibiting moderate solubility in organic solvents while being less soluble in water. It is primarily used in agricultural applications, particularly as a herbicide, due to its ability to inhibit the growth of certain plants. The presence of chlorine atoms in its structure contributes to its biological activity and stability. Additionally, 2,4-Dichlorobenzeneacetamide may pose environmental and health risks, necessitating careful handling and adherence to safety regulations. Its chemical properties, such as melting point, boiling point, and reactivity, can vary based on purity and environmental conditions, making it essential to consult specific data sheets for detailed information. Overall, this compound exemplifies the intersection of organic chemistry and agricultural science.
Formula:C8H7Cl2NO
InChI:InChI=1S/C8H7Cl2NO/c9-6-2-1-5(3-8(11)12)7(10)4-6/h1-2,4H,3H2,(H2,11,12)
InChI key:InChIKey=NAYAHQPYRSIGCX-UHFFFAOYSA-N
SMILES:C(C(N)=O)C1=C(Cl)C=C(Cl)C=C1
Synonyms:
  • 2,4-Dichlorobenzeneacetamide
  • 2,4-Dichlorophenylacetamide
  • 2-(2,4-Dichlorophenyl)acetamide
  • Benzeneacetamide, 2,4-dichloro-
Found 4 products.