CAS 55956-21-3

2-[(1-methoxypropan-2-yl)oxy]propan-1-ol

Description:

2-[(1-Methoxypropan-2-yl)oxy]propan-1-ol, with the CAS number 55956-21-3, is an organic compound characterized by its ether and alcohol functional groups. It features a propanol backbone, which contributes to its solubility in water and polar solvents. The presence of the methoxy group enhances its reactivity and potential as a solvent or intermediate in organic synthesis. This compound is typically a colorless liquid with a mild odor, and it exhibits moderate volatility. Its molecular structure allows for hydrogen bonding, which can influence its physical properties, such as boiling point and viscosity. Additionally, it may serve as a surfactant or emulsifier due to its amphiphilic nature. Safety data indicates that it should be handled with care, as it may cause irritation upon contact with skin or eyes. Overall, 2-[(1-methoxypropan-2-yl)oxy]propan-1-ol is a versatile compound with applications in various chemical processes and formulations.

Formula: C₇H₁₆O₃

InChI: InChI=1/C7H16O3/c1-6(4-8)10-7(2)5-9-3/h6-8H,4-5H2,1-3H3

SMILES: CC(CO)OC(C)COC

Synonyms:

• 1-Propanol, 2-(2-Methoxy-1-Methylethoxy)-
• 2-(2-Methoxy-1-Methylethoxy)-1-Propanol

2-(2-Methoxy-1-methylethoxy)-1-propanol

Controlled Product

CAS: 55956-21-3

Formula: C₇H₁₆O₃

Color and Shape: Neat

Molecular weight: 148.2

Ref: TR-M264250