CymitQuimica logo

CAS 5599-71-3

:

3,6-dichloro-9H-carbazole

Description:
3,6-Dichloro-9H-carbazole is an organic compound characterized by its structure, which features a carbazole backbone with chlorine substituents at the 3 and 6 positions. This compound is typically a solid at room temperature and exhibits a crystalline form. It is known for its relatively high thermal stability and can be soluble in organic solvents such as chloroform and dichloromethane, but is generally insoluble in water. The presence of chlorine atoms enhances its electronic properties, making it of interest in various applications, including organic electronics and as a potential intermediate in the synthesis of dyes and pigments. Additionally, 3,6-dichloro-9H-carbazole may exhibit photoluminescent properties, which can be advantageous in optoelectronic devices. Safety considerations should be taken into account, as with many chlorinated compounds, due to potential toxicity and environmental impact. Proper handling and disposal methods are essential to mitigate any risks associated with its use.
Formula:C12H7Cl2N
InChI:InChI=1/C12H7Cl2N/c13-7-1-3-11-9(5-7)10-6-8(14)2-4-12(10)15-11/h1-6,15H
InChI key:BIMDTNQPZWJKPL-UHFFFAOYSA-N
SMILES:c1cc2c(cc1Cl)c1cc(ccc1[nH]2)Cl
Synonyms:
  • 3,6-Dichlorocarbazole
  • 9H-carbazole, 3,6-dichloro-
  • Carbazole, 3,6-dichloro-
Found 6 products.