CAS 560088-79-1

Boc-8-amino-3,6-dioxaoctanoic acid DCHA

Description:

Boc-8-amino-3,6-dioxaoctanoic acid DCHA, with the CAS number 560088-79-1, is a synthetic compound characterized by its unique structure that includes a Boc (tert-butyloxycarbonyl) protecting group, an amino group, and a dioxaoctanoic acid backbone. This compound is typically used in peptide synthesis and drug development due to its ability to provide stability and protect functional groups during chemical reactions. The presence of the dioxaoctanoic acid moiety contributes to its solubility and potential bioactivity. The Boc group is commonly employed in organic synthesis to temporarily protect amines, allowing for selective reactions without interference. Additionally, the DCHA (dihydrochloride) salt form enhances the compound's stability and solubility in aqueous environments, making it suitable for various biochemical applications. Overall, Boc-8-amino-3,6-dioxaoctanoic acid DCHA is a versatile building block in medicinal chemistry and peptide synthesis, facilitating the development of complex molecules with therapeutic potential.

Formula: C₂₃H₄₄N₂O₆

InChI: InChI=1S/C12H23N.C11H21NO6/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-11(2,3)18-10(15)12-4-5-16-6-7-17-8-9(13)14/h11-13H,1-10H2;4-8H2,1-3H3,(H,12,15)(H,13,14)

InChI key: SWUXEYKTUQROOO-UHFFFAOYSA-N

SMILES: CC(C)(C)OC(=O)NCCOCCOCC(=O)O.C1CCC(CC1)NC2CCCCC2

Synonyms:

• Boc-8-amino-3,6-dioxaoctanoic acid dicyclohexylamine salt
• Boc-[2-(2-amino-ethoxy)-ethoxy]-acetic acid
• 2-[2-(Boc-amino)ethoxy]ethoxyacetic acid dicyclohexylamine salt

Boc-8-Amino-3,6-dioxaoctanoic acid.DCHA

CAS: 560088-79-1

Formula: C₂₃H₄₄N₂O₆

Purity: 97%

Color and Shape: Solid

Molecular weight: 444.613

Ref: 10-F079624

Boc-AEEA.DCHA

CAS: 560088-79-1

Boc-AEEA.DCHA

Formula: C₁₁H₂₀NO₆·C₁₂H₂₄N

Purity: >98%

Molecular weight: 444.60525

Ref: 54-BIBP1014

Boc-NH-PEG2-CH2COOH dicyclohexylamine

CAS: 560088-79-1

Boc-NH-PEG2-CH2COOH (dicyclohexylamine) is a PROTAC linker utilized in the synthesis of PROTAC molecules.

Formula: C₂₃H₄₄N₂O₆

Molecular weight: 444.6053

Ref: TM-T216887

Dicyclohexylamine 2,2-Dimethyl-4-Oxo-3,8,11-Trioxa-5-Azatridecan-13-Oate

CAS: 560088-79-1

Formula: C₂₃H₄₄N₂O₆

Purity: 97%

Color and Shape: Solid

Molecular weight: 444.6053

Ref: IN-DA003OFO

Boc-AEEA-OH.DCHA

CAS: 560088-79-1

Dicyclohexylamine 2,2-dimethyl-4-oxo-3,8,11-trioxa-5-azatridecan-13-oate

Formula: C₂₃H₄₄N₂O₆

Purity: 98%

Molecular weight: 444.61

Ref: IN-DG211859

Boc-mini-PEG Boc-8-Amino-3,6-Dioxaoctanoic Acid . DCHA

Controlled Product

CAS: 560088-79-1

Boc-mini-PEG Boc-8-Amino-3,6-Dioxaoctanoic Acid . DCHA is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. Boc-mini-PEG Boc-8-Amino-3,6-Dioxaoctanoic Acid . DCHA is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.

Formula: C₁₁H₂₁NO₆•C₁₂H₂₃N

Purity: Min. 95%

Molecular weight: 444.59 g/mol

Ref: 3D-BXX-5519-PI