CymitQuimica logo

CAS 5602-94-8

:

ethyl N-(methoxycarbonyl)glycinate

Description:
Ethyl N-(methoxycarbonyl)glycinate, with the CAS number 5602-94-8, is an organic compound that belongs to the class of amino acid derivatives. It features a glycine backbone, where the amino group is substituted with an ethyl ester and a methoxycarbonyl group, contributing to its unique properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is soluble in polar organic solvents, which makes it useful in various chemical reactions and applications, particularly in the synthesis of pharmaceuticals and agrochemicals. Ethyl N-(methoxycarbonyl)glycinate can participate in reactions such as esterification and amidation, making it a versatile intermediate in organic synthesis. Additionally, it may exhibit biological activity, which can be explored in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C6H11NO4
InChI:InChI=1/C6H11NO4/c1-3-11-5(8)4-7-6(9)10-2/h3-4H2,1-2H3,(H,7,9)
InChI key:LNYUJLIYAHJNNO-UHFFFAOYSA-N
SMILES:CCOC(=O)CN=C(O)OC
Found 4 products.