CymitQuimica logo

CAS 56042-83-2

:

2-amino-5-chloro-N,N-dimethylbenzamide

Description:
2-Amino-5-chloro-N,N-dimethylbenzamide is an organic compound characterized by its amide functional group, which is derived from benzoic acid. It features a benzene ring substituted with an amino group at the para position and a chlorine atom at the meta position relative to the amine. The presence of two methyl groups attached to the nitrogen atom of the amide enhances its lipophilicity and may influence its biological activity. This compound is typically a solid at room temperature and is soluble in polar organic solvents. Its chemical structure suggests potential applications in pharmaceuticals, particularly as a building block in the synthesis of biologically active molecules. The chlorine substituent can also impart unique reactivity, making it useful in various chemical reactions. Safety data should be consulted for handling, as with any chemical, to ensure proper precautions are taken due to potential toxicity or environmental impact.
Formula:C9H11ClN2O
InChI:InChI=1/C9H11ClN2O/c1-12(2)9(13)7-5-6(10)3-4-8(7)11/h3-5H,11H2,1-2H3
SMILES:CN(C)C(=O)c1cc(ccc1N)Cl
Found 1 products.