CymitQuimica logo

CAS 56146-89-5

:

benzyl N-[6-[[(2R,3S,4R,5S)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]amino]-6-oxo-hexyl]carbamate

Description:
Benzyl N-[6-[[(2R,3S,4R,5S)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]amino]-6-oxo-hexyl]carbamate, with CAS number 56146-89-5, is a complex organic compound characterized by its multi-functional structure. It features a carbamate functional group, which is known for its role in various biological activities, including potential pharmaceutical applications. The presence of a tetrahydropyran ring indicates that it may exhibit stereochemical properties that can influence its reactivity and interactions with biological systems. The acetamido and hydroxymethyl groups suggest potential for hydrogen bonding, which can enhance solubility and bioavailability. This compound may also possess antimicrobial or antiviral properties, typical of many carbamate derivatives. Its intricate structure implies that it could be of interest in medicinal chemistry, particularly in the development of therapeutics targeting specific biological pathways. However, detailed studies would be necessary to fully elucidate its properties, mechanisms of action, and potential applications in drug development.
Formula:C22H33N3O8
InChI:InChI=1/C22H33N3O8/c1-14(27)24-18-20(30)19(29)16(12-26)33-21(18)25-17(28)10-6-3-7-11-23-22(31)32-13-15-8-4-2-5-9-15/h2,4-5,8-9,16,18-21,26,29-30H,3,6-7,10-13H2,1H3,(H,23,31)(H,24,27)(H,25,28)/t16?,18-,19+,20+,21+/m0/s1
InChI key:KMJIVMWBZJORPU-GHRYLNIYSA-N
SMILES:CC(=O)N[C@@H]1[C@H]([C@@H]([C@H](O[C@H]1NC(=O)CCCCCNC(=O)OCC2=CC=CC=C2)CO)O)O
Found 3 products.