CymitQuimica logo

CAS 5616-30-8

:

Sulfanilylglycine

Description:
Sulfanilylglycine, with the CAS number 5616-30-8, is an organic compound that belongs to the class of sulfonamides. It is characterized by the presence of a sulfanilamide group, which is a sulfonic acid derivative, and an amino acid structure, specifically glycine. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to its polar functional groups. Sulfanilylglycine exhibits properties that make it useful in various biochemical applications, particularly in the study of enzyme inhibition and as a potential intermediate in the synthesis of pharmaceuticals. Its structure allows it to participate in various chemical reactions, including acylation and coupling reactions. Additionally, it may have antibacterial properties, similar to other sulfonamides, although its specific biological activity can vary. As with many sulfonamides, care should be taken when handling this compound, as it may cause allergic reactions in sensitive individuals. Overall, sulfanilylglycine is a significant compound in both organic chemistry and medicinal chemistry contexts.
Formula:C8H10N2O4S
InChI:InChI=1S/C8H10N2O4S/c9-6-1-3-7(4-2-6)15(13,14)10-5-8(11)12/h1-4,10H,5,9H2,(H,11,12)
InChI key:InChIKey=BPJUMYMTQYMSFZ-UHFFFAOYSA-N
SMILES:S(NCC(O)=O)(=O)(=O)C1=CC=C(N)C=C1
Synonyms:
  • Glycine, N-[(4-aminophenyl)sulfonyl]-
  • Sulfanilylglycine
  • ((4-Aminophenyl)sulfonyl)glycine
  • N-[(4-Aminophenyl)sulfonyl]glycine
  • Glycine, N-sulfanilyl-
Found 1 products.