CymitQuimica logo

CAS 5617-99-2

:

Cyclopropaneoctanoic acid

Description:
Cyclopropaneoctanoic acid, identified by its CAS number 5617-99-2, is a cyclic fatty acid characterized by a cyclopropane ring attached to an octanoic acid chain. This compound features a unique structure that combines the properties of both cyclic and linear fatty acids, which can influence its physical and chemical behavior. Typically, cyclopropane derivatives exhibit increased strain due to the three-membered ring, which can lead to distinctive reactivity patterns compared to their acyclic counterparts. Cyclopropaneoctanoic acid may demonstrate solubility in organic solvents and limited solubility in water, reflecting the hydrophobic nature of its long carbon chain. Its potential applications could span various fields, including organic synthesis and materials science, where the unique structural properties may be exploited. Additionally, the presence of the cyclopropane moiety may impart interesting biological activities, although specific studies would be necessary to elucidate its biological effects and potential uses in pharmaceuticals or agrochemicals. Overall, cyclopropaneoctanoic acid represents a fascinating compound within the realm of organic chemistry.
Formula:C11H20O2
InChI:InChI=1S/C11H20O2/c12-11(13)7-5-3-1-2-4-6-10-8-9-10/h10H,1-9H2,(H,12,13)
InChI key:InChIKey=NDHMBVUODHGBAF-UHFFFAOYSA-N
SMILES:C(CCCCCCC(O)=O)C1CC1
Synonyms:
  • Cyclopropaneoctanoic acid
Found 1 products.