CymitQuimica logo

CAS 5624-08-8

:

5-Oxo-1-phenyl-2-thioxo-4-imidazolidineacetamide

Description:
5-Oxo-1-phenyl-2-thioxo-4-imidazolidineacetamide, with the CAS number 5624-08-8, is a chemical compound that belongs to the class of imidazolidine derivatives. This compound features a five-membered ring structure containing both nitrogen and sulfur atoms, contributing to its unique reactivity and properties. The presence of a phenyl group enhances its aromatic characteristics, which can influence its solubility and interaction with biological systems. The thioxo group (–C=S) is notable for its potential to participate in various chemical reactions, including nucleophilic attacks and coordination with metal ions. Additionally, the oxo group (–C=O) plays a crucial role in the compound's reactivity, particularly in forming hydrogen bonds. This compound may exhibit biological activity, making it of interest in medicinal chemistry, although specific pharmacological properties would require further investigation. Overall, 5-Oxo-1-phenyl-2-thioxo-4-imidazolidineacetamide is characterized by its unique structural features, which contribute to its potential applications in various chemical and biological contexts.
Formula:C11H11N3O2S
InChI:InChI=1S/C11H11N3O2S/c12-9(15)6-8-10(16)14(11(17)13-8)7-4-2-1-3-5-7/h1-5,8H,6H2,(H2,12,15)(H,13,17)
InChI key:InChIKey=ZQGVIKNSDQBZSS-UHFFFAOYSA-N
SMILES:O=C1N(C(=S)NC1CC(N)=O)C2=CC=CC=C2
Synonyms:
  • Asparagine phenylthiohydantoin
  • 5-Oxo-1-phenyl-2-thioxo-4-imidazolidineacetamide
  • Phenylthiohydantoin DL-asparagine
  • 4-Imidazolidineacetamide, 5-oxo-1-phenyl-2-thioxo-
  • 5-Hydantoinacetamide, 3-phenyl-2-thio-
Found 2 products.