CymitQuimica logo

CAS 56241-09-9

:

4-Chloro-1(2H)-isoquinolone

Description:
4-Chloro-1(2H)-isoquinolone is a heterocyclic organic compound characterized by its isoquinolone structure, which consists of a fused benzene and pyridine ring system. The presence of a chlorine atom at the 4-position of the isoquinolone ring significantly influences its chemical properties and reactivity. This compound typically exhibits a pale yellow to off-white crystalline appearance and is soluble in organic solvents such as dimethyl sulfoxide (DMSO) and ethanol, but may have limited solubility in water. It is often utilized in medicinal chemistry and research due to its potential biological activities, including antimicrobial and anticancer properties. The compound's molecular structure allows for various substitution reactions, making it a valuable intermediate in the synthesis of more complex molecules. Additionally, its stability under standard laboratory conditions makes it suitable for various applications in organic synthesis and pharmaceutical development. As with many halogenated compounds, appropriate safety measures should be taken when handling 4-Chloro-1(2H)-isoquinolone due to potential toxicity and environmental impact.
Formula:C9H6ClNO
InChI:InChI=1/C9H6ClNO/c10-8-5-11-9(12)7-4-2-1-3-6(7)8/h1-5H,(H,11,12)
InChI key:MVWIXKFNHOXLBU-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)c(cnc2O)Cl
Synonyms:
  • 4-chloroisoquinolin-1(2H)-one
Found 5 products.