CAS 56279-35-7

(1E)-1-methoxy-2-methylpent-1-en-3-one

Description:

(1E)-1-methoxy-2-methylpent-1-en-3-one, with the CAS number 56279-35-7, is an organic compound characterized by its unique structure that includes a methoxy group and a conjugated double bond. This compound features a pentene backbone, indicating it has five carbon atoms and a double bond located at the first position. The presence of the methoxy group (-OCH3) contributes to its reactivity and solubility properties, making it polar and capable of participating in various chemical reactions, such as nucleophilic substitutions. The compound is likely to exhibit a range of physical properties, including a specific boiling point and melting point, influenced by its molecular structure and functional groups. Additionally, due to the presence of the enone functional group, it may engage in Michael addition reactions and other transformations typical of α,β-unsaturated carbonyl compounds. Its applications could span fields such as organic synthesis, fragrance formulation, or as an intermediate in the production of more complex molecules.

Formula: C₇H₁₂O₂

InChI: InChI=1/C7H12O2/c1-4-7(8)6(2)5-9-3/h5H,4H2,1-3H3/b6-5+

InChI key: AIFFWMXMBCHYFL-AATRIKPKSA-N

SMILES: CCC(=O)/C(=C/OC)/C

(1E)-1-Methoxy-2-methyl-1-penten-3-one

CAS: 56279-35-7

Formula: C₇H₁₂O₂

Molecular weight: 128.1690

Ref: IN-DA003BFD