CAS 56311-37-6
:5-ethylfuran-2-carboxylic acid
Description:
5-Ethylfuran-2-carboxylic acid is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing one oxygen atom. This compound features an ethyl group attached to the furan ring and a carboxylic acid functional group (-COOH) at the 2-position. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and decarboxylation. The ethyl substituent influences the compound's solubility and reactivity, making it more hydrophobic compared to its non-substituted counterparts. 5-Ethylfuran-2-carboxylic acid may be utilized in organic synthesis and could serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its unique structure and functional groups also make it a subject of interest in studies related to furan derivatives and their applications in various fields, including materials science and medicinal chemistry. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C7H8O3
InChI:InChI=1/C7H8O3/c1-2-5-3-4-6(10-5)7(8)9/h3-4H,2H2,1H3,(H,8,9)
SMILES:CCc1ccc(C(=O)O)o1
Synonyms:- 2-Furancarboxylic Acid, 5-Ethyl-
- 5-Ethyl-2-Furoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
5-ethylfuran-2-carboxylic acid
CAS:Formula:C7H8O3Purity:97%Color and Shape:SolidMolecular weight:140.13665-Ethyl-furan-2-carboxylic acid
CAS:Formula:C7H8O3Purity:95.0%Color and Shape:SolidMolecular weight:140.1385-Et-furan-2-carboxylic acid
CAS:5-Ethyl-furan-2-carboxylic acid is a tetrahydrofuran that can be synthesized from benzaldehyde and lithium. It has cytotoxic properties, which may be due to its acid derivative intermediates. The regiospecificity of this compound is also notable, as it was lithiated at the 5-position. This synthetic compound is an intermediate in the synthesis of other drugs such as alpidem or zolpidem.Formula:C7H8O3Purity:Min. 95%Molecular weight:140.14 g/mol


