CymitQuimica logo

CAS 56315-19-6

:

Tributyloctylphosphonium chloride

Description:
Tributyloctylphosphonium chloride is an ionic liquid that belongs to the class of phosphonium salts. It is characterized by its unique structure, which consists of a bulky tributyloctylphosphonium cation and a chloride anion. This compound is typically colorless to pale yellow and exhibits a low melting point, making it liquid at room temperature. Its hydrophobic nature and high thermal stability make it suitable for various applications, including as a solvent in chemical reactions, in extraction processes, and in the development of advanced materials. Additionally, tributyloctylphosphonium chloride demonstrates good solubility in organic solvents while being insoluble in water, which enhances its utility in organic synthesis and catalysis. The presence of the phosphonium group contributes to its ability to form stable complexes with various anions, further expanding its potential applications in fields such as electrochemistry and materials science. Overall, tributyloctylphosphonium chloride is a versatile compound with significant relevance in both industrial and research settings.
Formula:C20H44P·Cl
InChI:InChI=1S/C20H44P.ClH/c1-5-9-13-14-15-16-20-21(17-10-6-2,18-11-7-3)19-12-8-4;/h5-20H2,1-4H3;1H/q+1;/p-1
InChI key:InChIKey=JDAJRHLAMCYXAN-UHFFFAOYSA-M
SMILES:[P+](CCCCCCCC)(CCCC)(CCCC)CCCC.[Cl-]
Synonyms:
  • Phosphonium, tributyloctyl-, chloride (1:1)
  • Octyltributylphosphonium chloride
  • Cyphos 253
  • Phosphonium, tributyloctyl-, chloride
  • Tributyloctylphosphonium chloride
Found 2 products.