CAS 563538-34-1
:(2,4-Dichlorophenyl)-1-piperazinylmethanone
Description:
(2,4-Dichlorophenyl)-1-piperazinylmethanone, identified by its CAS number 563538-34-1, is a chemical compound that features a piperazine moiety linked to a dichlorophenyl group and a carbonyl functional group. This compound typically exhibits characteristics common to piperazine derivatives, including potential psychoactive properties and interactions with various neurotransmitter systems. The presence of the dichlorophenyl group suggests that it may possess lipophilic properties, which can influence its bioavailability and pharmacokinetics. Additionally, the carbonyl group contributes to the compound's reactivity and potential for forming hydrogen bonds, which can affect its solubility in different solvents. Such compounds are often studied for their biological activity, including potential applications in pharmaceuticals, particularly in the development of drugs targeting central nervous system disorders. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C11H12Cl2N2O
InChI:InChI=1S/C11H12Cl2N2O/c12-8-1-2-9(10(13)7-8)11(16)15-5-3-14-4-6-15/h1-2,7,14H,3-6H2
InChI key:InChIKey=SJRJXDNAXPFNPP-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(Cl)C=C(Cl)C=C1)N2CCNCC2
Synonyms:- (2,4-Dichlorophenyl)-1-piperazinylmethanone
- 1-(2,4-Dichlorobenzoyl)piperazine
- Methanone, (2,4-dichlorophenyl)-1-piperazinyl-
- Piperazine, 1-(2,4-dichlorobenzoyl)-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
