CymitQuimica logo

CAS 5637-87-6

:

1,3,5-Triazine, 2,4,6-triiodo-

Description:
1,3,5-Triazine, 2,4,6-triiodo- is a heterocyclic compound characterized by a triazine ring with three iodine atoms substituted at the 2, 4, and 6 positions. This compound is notable for its stability and resistance to degradation, which is attributed to the presence of the triazine ring, a structure known for its aromaticity and electron-withdrawing properties. The iodine substituents enhance its photophysical properties, making it useful in various applications, including as a dye or pigment. Additionally, the presence of iodine can impart unique reactivity, influencing its interactions in chemical reactions. The compound is typically synthesized through halogenation processes involving triazine derivatives. Due to its iodine content, it may exhibit antimicrobial properties and has potential applications in agricultural chemistry. However, handling and disposal must be approached with caution due to the toxicity associated with iodine-containing compounds. Overall, 1,3,5-Triazine, 2,4,6-triiodo- is a significant compound in both synthetic and applied chemistry contexts.
Formula:C3I3N3
InChI:InChI=1/C13H7Cl3I2N2O/c14-7-2-9(15)12(10(16)3-7)20-19-5-6-1-8(17)4-11(18)13(6)21/h1-5,19-20H/b6-5+
InChI key:RIRMMJBLWVZDJF-UHFFFAOYSA-N
SMILES:C1(=NC(=NC(=N1)I)I)I
Synonyms:
  • 2,4,6-Triiodo-1,3,5-triazine
  • 1,3,5-Triazine, 2,4,6-triiodo-
  • See more synonyms
Found 3 products.