CAS 56453-86-2
:(2E)-3-cyclohexylprop-2-enoic acid
Description:
(2E)-3-Cyclohexylprop-2-enoic acid, with the CAS number 56453-86-2, is an organic compound characterized by its unsaturated carboxylic acid structure. It features a cyclohexyl group attached to a prop-2-enoic acid backbone, which imparts unique chemical properties. The presence of the double bond in the prop-2-enoic moiety contributes to its reactivity, allowing for potential participation in various chemical reactions such as polymerization and addition reactions. This compound is typically a colorless to pale yellow liquid at room temperature and may exhibit a characteristic odor. Its solubility in organic solvents, along with limited solubility in water, reflects its hydrophobic nature due to the cyclohexyl group. The compound's acidity is attributed to the carboxylic acid functional group, which can donate protons in solution. Additionally, (2E)-3-cyclohexylprop-2-enoic acid may have applications in organic synthesis and materials science, particularly in the development of specialty chemicals and polymers.
Formula:C9H14O2
InChI:InChI=1/C9H14O2/c10-9(11)7-6-8-4-2-1-3-5-8/h6-8H,1-5H2,(H,10,11)/b7-6+
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(E)-3-Cyclohexylacrylic acid
CAS:(E)-3-Cyclohexylacrylic acidFormula:C9H14O2Purity:95%Molecular weight:154.21(E)-3-Cyclohexylacrylic acid
CAS:Formula:C9H14O2Purity:96%Color and Shape:SolidMolecular weight:154.2063(E)-3-Cyclohexylacrylic acid
CAS:(E)-3-Cyclohexylacrylic acidFormula:C9H14O2Purity:98%Molecular weight:154.21(E)-3-Cyclohexylacrylic acid
CAS:(E)-3-Cyclohexylacrylic acid is an antibacterial agent that inhibits the growth of bacteria by binding to the 50S ribosomal subunit. It binds to bacterial 16S ribosomal RNA and inhibits protein synthesis, leading to cell death by inhibiting the production of proteins vital for cell division. (E)-3-Cyclohexylacrylic acid has been shown to be effective against methicillin-resistant Staphylococcus aureus (MRSA) and Clostridium perfringens, although is not active against acid-fast bacteria such as Mycobacterium tuberculosis or Mycobacterium avium complex. This compound also has anticancer activity, which may be due to its ability to inhibit topoisomerase II activity in cells.Formula:C9H14O2Purity:Min. 95%Molecular weight:154.21 g/mol(E)-3-Cyclohexylacrylic acid
CAS:Formula:C9H14O2Purity:96%Color and Shape:SolidMolecular weight:154.209




