CAS 5649-07-0
:(val5)-angiotensin ii acetate
Description:
(val5)-Angiotensin II acetate, with the CAS number 5649-07-0, is a synthetic peptide that is a derivative of angiotensin II, a key regulator in the renin-angiotensin system, which plays a crucial role in blood pressure regulation and fluid balance. This compound is characterized by its specific amino acid sequence, which includes a valine at the fifth position, distinguishing it from other angiotensin II variants. It typically exhibits biological activity by binding to angiotensin receptors, influencing vasoconstriction and aldosterone secretion. The acetate form indicates that it is acetylated, which can enhance its stability and solubility in biological systems. In research and therapeutic contexts, (val5)-angiotensin II acetate is often studied for its potential effects on cardiovascular health and its role in various physiological processes. Its properties, such as solubility, stability, and receptor affinity, make it a valuable compound in pharmacological studies and potential drug development.
Formula:C49H69N13O12
InChI:InChI=1S/C49H69N13O12.C2H4O2/c1-26(2)39(60-42(67)33(12-8-18-54-49(51)52)56-41(66)32(50)23-38(64)65)45(70)57-34(20-29-14-16-31(63)17-15-29)43(68)61-40(27(3)4)46(71)58-35(22-30-24-53-25-55-30)47(72)62-19-9-13-37(62)44(69)59-36(48(73)74)21-28-10-6-5-7-11-28;1-2(3)4/h5-7,10-11,14-17,24-27,32-37,39-40,63H,8-9,12-13,18-23,50H2,1-4H3,(H,53,55)(H,56,66)(H,57,70)(H,58,71)(H,59,69)(H,60,67)(H,61,68)(H,64,65)(H,73,74)(H4,51,52,54);1H3,(H,3,4)/t32-,33-,34-,35-,36-,37-,39-,40-;/m0./s1
InChI key:JVCJXRGXGITABA-IAQGTVMASA-N
SMILES:CC(C)[C@@H](C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC2=CN=CN2)C(=O)N3CCC[C@H]3C(=O)N[C@@H](CC4=CC=CC=C4)C(=O)O)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(=O)O)N.CC(=O)O
Synonyms:- [Val5]-Angiotensin II, Human
- [Val5]-Angiotensin Ii
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
[Val<sup>5</sup>] Angiotensin II, Human
CAS:For cellular and molecular biology applicationsFormula:C49H69N13O12Molecular weight:1032.155-L-Valineangiotensin II acetate
CAS:5-L-Valineangiotensin II acetateFormula:C51H73N13O14Purity:≥95%Molecular weight:1092.2[Val5]-Angiotensin II
CAS:Angiotensin II is a peptide hormone that regulates blood pressure and water balance. It is an important component of the renin-angiotensin system, which causes vasoconstriction and release of aldosterone from the adrenal gland. Angiotensin II binds to angiotensin receptors on cells, initiating a second messenger cascade that results in increased blood pressure and electrolyte retention. Val5-Angiotensin II is a synthetic form of this hormone that has been shown to increase glomerular filtration rate by inhibiting angiotensin converting enzyme (ACE). Angiotensin II also stimulates epidermal growth factor, which may be responsible for its anti-inflammatory effects. The optimum pH for Val5-Angiotensin II is between 7.0 and 8.0.
Formula:C49H69N13O12•CH3COOH•4H2OPurity:Min. 95%Molecular weight:1,164.31 g/mol




