CAS 56491-86-2
:2,2',2''-(1,4,7-triazonane-1,4,7-triyl)triacetic acid
Description:
2,2',2''-(1,4,7-triazonane-1,4,7-triyl)triacetic acid, also known by its CAS number 56491-86-2, is a chelating agent characterized by its ability to form stable complexes with metal ions. This compound features a triaza backbone, consisting of three nitrogen atoms in a cyclic arrangement, which enhances its coordination properties. The presence of three acetic acid functional groups allows for multiple binding sites, facilitating the formation of chelate complexes with various transition metals. This property makes it useful in applications such as metal ion extraction, catalysis, and as a potential agent in pharmaceuticals and biochemistry. The compound is typically soluble in water and exhibits a relatively high stability in solution, making it suitable for various chemical processes. Its structure contributes to its effectiveness in sequestering metal ions, which can be beneficial in both industrial and environmental contexts. Overall, 2,2',2''-(1,4,7-triazonane-1,4,7-triyl)triacetic acid is a versatile compound with significant implications in coordination chemistry and related fields.
Formula:C12H21N3O6
InChI:InChI=1/C12H21N3O6/c16-10(17)7-13-1-2-14(8-11(18)19)5-6-15(4-3-13)9-12(20)21/h1-9H2,(H,16,17)(H,18,19)(H,20,21)
SMILES:C1CN(CCN(CCN1CC(=O)O)CC(=O)O)CC(=O)O
Synonyms:- 2-[4,7-Bis(Carboxymethyl)-1,4,7-Triazonan-1-Yl]Acetic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,2',2''-(1,4,7-Triazonane-1,4,7-triyl)triacetic Acid
CAS:Formula:C12H21N3O6Purity:>97.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:303.322,2',2''-(1,4,7-Triazonane-1,4,7-Triyl)Triacetic Acid
CAS:2,2',2''-(1,4,7-Triazonane-1,4,7-Triyl)Triacetic AcidFormula:C12H21N3O6Purity:97%Molecular weight:303.31NOTA
CAS:2,2',2''-(1,4,7-Triazonane-1,4,7-triyl)triacetic acidFormula:C12H21N3O6Purity:97%Molecular weight:303.311,4,7-triazacyclononane-N,N',N''-triacetic acid
CAS:Formula:C12H21N3O6Purity:97%Color and Shape:SolidMolecular weight:303.3116NOTA
CAS:NOTA is a multifunctional chelator capable of forming stable complexes with metal ions in radiopharmaceuticals, molecular imaging and targeted nuclear therapy.Formula:C12H21N3O6Purity:98.04%Color and Shape:White SolidMolecular weight:303.312,2′,2”-(1,4,7-Triazonane-1,4,7-triyl)triacetic acid
CAS:Purity:98%Color and Shape:SolidMolecular weight:303.3150024





