CymitQuimica logo

CAS 56515-89-0

:

1H-Azepine-1-carboxylic acid, hexahydro-4-oxo-, ethyl ester

Description:
1H-Azepine-1-carboxylic acid, hexahydro-4-oxo-, ethyl ester, identified by CAS number 56515-89-0, is a chemical compound characterized by its cyclic structure, which includes a seven-membered nitrogen-containing ring (azepine) and a carboxylic acid functional group. This compound typically exhibits properties associated with both esters and cyclic amines, including moderate solubility in organic solvents and potential reactivity due to the presence of the carboxylic acid moiety. The hexahydro-4-oxo component indicates the presence of a saturated ring with a carbonyl group, contributing to its stability and reactivity. As an ester, it may undergo hydrolysis in the presence of water or acidic conditions, releasing the corresponding alcohol and carboxylic acid. The compound's unique structure may impart specific biological activities, making it of interest in medicinal chemistry and drug development. However, detailed information regarding its toxicity, environmental impact, and specific applications would require further investigation and analysis.
Formula:C9H15NO3
InChI:InChI=1S/C9H15NO3/c1-2-13-9(12)10-6-3-4-8(11)5-7-10/h2-7H2,1H3
InChI key:IBUMPBFHLUYONP-UHFFFAOYSA-N
SMILES:CCOC(=O)N1CCCC(=O)CC1
Found 4 products.