CAS 5653-65-6
:1-(3,4-dimethoxyphenyl)ethanol
Description:
1-(3,4-Dimethoxyphenyl)ethanol, with the CAS number 5653-65-6, is an organic compound characterized by its aromatic structure and alcohol functional group. It features a phenolic ring substituted with two methoxy groups at the 3 and 4 positions, which enhances its solubility in organic solvents and may influence its biological activity. The presence of the ethanol moiety contributes to its properties as a potential solvent and reagent in various chemical reactions. This compound is typically a colorless to pale yellow liquid, exhibiting moderate volatility and a relatively low boiling point. Its molecular structure suggests potential applications in pharmaceuticals and organic synthesis, particularly in the development of compounds with antioxidant or anti-inflammatory properties. Additionally, the methoxy groups can affect the compound's reactivity and interaction with biological systems, making it of interest in medicinal chemistry. As with many organic compounds, safety precautions should be observed when handling it, as it may pose health risks if ingested or inhaled.
Formula:C10H14O3
InChI:InChI=1/C10H14O3/c1-7(11)8-4-5-9(12-2)10(6-8)13-3/h4-7,11H,1-3H3
SMILES:CC(c1ccc(c(c1)OC)OC)O
Synonyms:- Benzenemethanol, 3,4-dimethoxy-alpha-methyl-
- 1-(3,4-Dimethoxyphenyl)ethanol
- Benzenemethanol, 3,4-dimethoxy-α-methyl-
- 3,4-dimethoxy-2-methylBenzenemethanol
- AKOS BBV-005644
- 1-(3,4-DIMETHOXYPHENYL)ETHAN-1-OL
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1-(3,4-Dimethoxyphenyl)ethanol
CAS:1-(3,4-Dimethoxyphenyl)ethanolFormula:C10H14O3Purity:97%Molecular weight:182.221-(3,4-Dimethoxyphenyl)ethanol
CAS:Formula:C10H14O3Purity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:182.221-(3,4-Dimethoxyphenyl)ethanol
CAS:1-(3,4-Dimethoxyphenyl)ethanolFormula:C10H14O3Purity:≥95%Color and Shape:LiquidMolecular weight:182.216351-(3,4-Dimethoxyphenyl)ethanol
CAS:Formula:C10H14O3Purity:97%Color and Shape:LiquidMolecular weight:182.21641-(3,4-Dimethoxyphenyl)ethanol
CAS:1-(3,4-Dimethoxyphenyl)ethanol (1DMPE) is a phenolic compound that is used in the production of dyes. It has strong redox potential and can be easily oxidized to form 1,2-dihydroxybenzene. This compound is susceptible to environmental pollution and also has the potential to react with other chemicals to form toxic products. 1DMPE can undergo acidolysis with trifluoroacetic acid or hydroxylation reactions with hydrogen peroxide or sodium perborate in the presence of a metal catalyst. These reactions produce carbonyl groups as reaction products and are kinetically controlled by activation energies. The mechanisms of these reactions have not been well studied, but they are thought to be due to kinetic effects.
Formula:C10H14O3Purity:Min. 95%Molecular weight:182.22 g/mol





