CymitQuimica logo

CAS 56613-81-1

:

(S)-(+)-2-Amino-1-phenylethanol

Description:
(S)-(+)-2-Amino-1-phenylethanol, with the CAS number 56613-81-1, is an organic compound characterized by its chiral structure, featuring an amino group and a phenyl group attached to a carbon chain. This compound is a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its role as a chiral building block in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. The presence of the amino group makes it a basic compound, capable of forming salts with acids. Its chirality is significant in biochemical applications, as the (S)-enantiomer can exhibit different biological activities compared to its (R)-counterpart. Additionally, (S)-(+)-2-amino-1-phenylethanol is soluble in water and organic solvents, which enhances its utility in various chemical reactions. Safety data indicates that it should be handled with care, as with many amines, due to potential irritant properties. Overall, this compound is valued for its versatility in synthetic chemistry and its importance in the development of chiral drugs.
Formula:C8H11NO
InChI:InChI=1S/C8H11NO/c9-6-8(10)7-4-2-1-3-5-7/h1-5,8,10H,6,9H2/t8-/m1/s1
InChI key:ULSIYEODSMZIPX-MRVPVSSYSA-N
SMILES:C1=CC=C(C=C1)[C@@H](CN)O
Synonyms:
  • (S)-(-)-2-Phenylglycinol
Found 6 products.