CAS 56632-74-7: 3-deoxy-3-fluoro-1,2-O-(1-methylethylidene)-6-O-(phenylcarbonyl)-alpha-D-glucofuranose

Description:3-Deoxy-3-fluoro-1,2-O-(1-methylethylidene)-6-O-(phenylcarbonyl)-alpha-D-glucofuranose is a synthetic carbohydrate derivative characterized by the presence of a fluorine atom at the 3-position of the glucose molecule, which can influence its biological activity and reactivity. The compound features a methylethylidene protecting group at the 1 and 2 positions, which is commonly used to stabilize the anomeric carbon during synthesis. Additionally, the phenylcarbonyl group at the 6-position enhances the compound's lipophilicity and may facilitate interactions with biological targets. This compound is likely to exhibit unique properties due to the combination of its structural modifications, including altered solubility, stability, and potential reactivity in biochemical pathways. Its specific applications may include use in medicinal chemistry, particularly in the development of glycosylated drugs or as a tool in carbohydrate chemistry for studying enzyme interactions. As with many synthetic derivatives, careful consideration of its synthesis, stability, and biological implications is essential for practical applications.

Formula:C₁₆H₁₉FO₆

InChI:InChI=1/C16H19FO6/c1-16(2)22-13-11(17)12(21-15(13)23-16)10(18)8-20-14(19)9-6-4-3-5-7-9/h3-7,10-13,15,18H,8H2,1-2H3/t10-,11+,12-,13-,15-/m1/s1