CAS 56700-70-0
:3-(Boc-amino)pyridine
Description:
3-(Boc-amino)pyridine, with the CAS number 56700-70-0, is a chemical compound characterized by the presence of a pyridine ring substituted with a tert-butyloxycarbonyl (Boc) protected amino group at the 3-position. This compound typically appears as a solid and is soluble in organic solvents such as dichloromethane and dimethyl sulfoxide, but may have limited solubility in water. The Boc group serves as a protective group for the amino functionality, making it useful in various synthetic applications, particularly in peptide synthesis and medicinal chemistry. The presence of the pyridine ring contributes to its aromatic properties and potential biological activity. 3-(Boc-amino)pyridine can be utilized in the development of pharmaceuticals and agrochemicals, as well as in the synthesis of more complex organic molecules. Its reactivity can be influenced by the electronic properties of the pyridine ring and the Boc group, allowing for selective transformations in organic synthesis. Proper handling and storage conditions should be observed due to its chemical nature.
Formula:C10H14N2O2
InChI:InChI=1/C10H14N2O2/c1-10(2,3)14-9(13)12-8-5-4-6-11-7-8/h4-7H,1-3H3,(H,12,13)
InChI key:WKHGDPZRLXDVMJ-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=Nc1cccnc1)O
Synonyms:- 3-(tert-Butoxycarbonylamino)pyridine
- Tert-Butyl Pyridin-3-Ylcarbamate
- 3-Tert-Butoxycarbonylaminopyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
tert-Butyl pyridin-3-ylcarbamate
CAS:Formula:C10H14N2O2Purity:98%Color and Shape:SolidMolecular weight:194.2304Alogliptin Impurity 3
CAS:Formula:C10H14N2O2Color and Shape:White To Off-White SolidMolecular weight:194.23tert-Butyl pyridin-3-ylcarbamate
CAS:tert-Butyl pyridin-3-ylcarbamateFormula:C10H14N2O2Purity:98%Molecular weight:194.23tert-butyl N-(pyridin-3-yl)carbamate
CAS:tert-butyl N-(pyridin-3-yl)carbamateFormula:C10H14N2O2Purity:>98%Molecular weight:194.23035tert-Butyl pyridin-3-ylcarbamate
CAS:Formula:C10H14N2O2Purity:95%Color and Shape:SolidMolecular weight:194.2343-(Boc-amino)pyridine
CAS:3-(Boc-amino)pyridine is a glycine derivative with a trigonal, chelate ring. It can be hydrolyzed by acid to form 3-aminopyridine. 3-(Boc-amino)pyridine has been shown to react with trimethyltin chloride to form an intramolecular complex in the presence of alkyllithiums. This reaction proceeds through lithiation and methylation of the carboxyl group of 3-(Boc-amino)pyridine. The interaction between 3-(Boc-amino)pyridine and trimethyltin chloride forms an antiaromatic six membered ring that resembles a benzene molecule.Formula:C10H14N2O2Purity:Min. 95%Molecular weight:194.23 g/mol






