CymitQuimica logo

CAS 5680-51-3

:

cyclopropyl(3-nitrophenyl)methanone

Description:
Cyclopropyl(3-nitrophenyl)methanone, with the CAS number 5680-51-3, is an organic compound characterized by its unique structural features. It consists of a cyclopropyl group attached to a methanone functional group, which is further linked to a 3-nitrophenyl moiety. This compound exhibits a relatively low molecular weight and is typically a solid at room temperature. The presence of the nitro group on the phenyl ring contributes to its electron-withdrawing properties, influencing its reactivity and potential applications in organic synthesis. Cyclopropyl groups are known for their strain and unique reactivity, which can lead to interesting chemical behavior. The compound may be utilized in various chemical reactions, including nucleophilic substitutions and as a building block in the synthesis of more complex molecules. Its properties, such as solubility and stability, can vary depending on the solvent and environmental conditions. Overall, cyclopropyl(3-nitrophenyl)methanone is a valuable compound in the field of organic chemistry, particularly in the development of pharmaceuticals and agrochemicals.
Formula:C10H9NO3
InChI:InChI=1/C10H9NO3/c12-10(7-4-5-7)8-2-1-3-9(6-8)11(13)14/h1-3,6-7H,4-5H2
InChI key:SPBSPZKRZGRRSE-UHFFFAOYSA-N
SMILES:c1cc(cc(c1)N(=O)=O)C(=O)C1CC1
Synonyms:
  • L3Tj Avr Cnw [Wln]
  • Methanone, cyclopropyl(3-nitrophenyl)-
  • Cyclopropyl(3-nitrophenyl)methanone
Found 3 products.