CAS 5690-46-0
:2-amino-1H-benzo[de]isoquinoline-1,3(2H)-dione
Description:
2-Amino-1H-benzo[de]isoquinoline-1,3(2H)-dione, with the CAS number 5690-46-0, is a heterocyclic organic compound characterized by its fused ring structure, which includes both isoquinoline and an amine functional group. This compound typically exhibits a solid state at room temperature and is known for its potential biological activities, including antitumor and antimicrobial properties. The presence of the amino group contributes to its reactivity, allowing for various chemical modifications. Its dione structure indicates the presence of two carbonyl groups, which can participate in hydrogen bonding and influence its solubility and reactivity in different solvents. The compound is of interest in medicinal chemistry and may serve as a scaffold for the development of new pharmaceuticals. Additionally, its unique structural features make it a subject of study in organic synthesis and material science. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C12H8N2O2
InChI:InChI=1/C12H8N2O2/c13-14-11(15)8-5-1-3-7-4-2-6-9(10(7)8)12(14)16/h1-6H,13H2
SMILES:c1cc2cccc3c2c(c1)c(=O)n(c3=O)N
Synonyms:- 1H-Benz[de]isoquinoline-1,3(2H)-dione, 2-amino-
- 2-Amino-benzo[de]isoquinoline-1,3-dione
- 2-Amino-1H-benzo(de)isoquinoline-1,3(2H)-dione
- 2-Amino-1H-benzo[de]isoquinoline-1,3(2H)-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-Amino-2,3-dihydro-1h-benzo[de]isoquinoline-1,3-dione
CAS:Formula:C12H8N2O2Purity:95%Color and Shape:SolidMolecular weight:212.20412-Amino-2,3-dihydro-1H-benzo[de]isoquinoline-1,3-dione
CAS:2-Amino-2,3-dihydro-1H-benzo[de]isoquinoline-1,3-dione
Color and Shape:PowderMolecular weight:212.20g/mol2-Amino-2,3-dihydro-1H-benzo[de]isoquinoline-1,3-dione
CAS:2-Amino-2,3-dihydro-1H-benzo[de]isoquinoline-1,3-dione (BENZENE) is a chemical compound that has been used to study the photochemical properties of epoxides. It is also used as a starting material in the synthesis of polymers. The synthesis of polymers may be accomplished by cationic polymerization or ring opening. Nitro groups on BENZENE are commonly used to synthesize nitro polymers and other compounds containing nitro groups. This chemical can be synthesized by chlorination with formamide and subsequent reaction with nitrous acid or acrylates. BENZENE is also capable of localizing fluorescent dyes within a specific region of a sample and can be used to measure distances between molecules.Formula:C12H8N2O2Purity:Min. 95%Molecular weight:212.2 g/mol


