CymitQuimica logo

CAS 5690-46-0

:

2-amino-1H-benzo[de]isoquinoline-1,3(2H)-dione

Description:
2-Amino-1H-benzo[de]isoquinoline-1,3(2H)-dione, with the CAS number 5690-46-0, is a heterocyclic organic compound characterized by its fused ring structure, which includes both isoquinoline and an amine functional group. This compound typically exhibits a solid state at room temperature and is known for its potential biological activities, including antitumor and antimicrobial properties. The presence of the amino group contributes to its reactivity, allowing for various chemical modifications. Its dione structure indicates the presence of two carbonyl groups, which can participate in hydrogen bonding and influence its solubility and reactivity in different solvents. The compound is of interest in medicinal chemistry and may serve as a scaffold for the development of new pharmaceuticals. Additionally, its unique structural features make it a subject of study in organic synthesis and material science. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C12H8N2O2
InChI:InChI=1/C12H8N2O2/c13-14-11(15)8-5-1-3-7-4-2-6-9(10(7)8)12(14)16/h1-6H,13H2
InChI key:HXJBFRDWVHNPAS-UHFFFAOYSA-N
SMILES:c1cc2cccc3c2c(c1)c(=O)n(c3=O)N
Synonyms:
  • 1H-Benz[de]isoquinoline-1,3(2H)-dione, 2-amino-
  • 2-Amino-benzo[de]isoquinoline-1,3-dione
  • 2-Amino-1H-benzo(de)isoquinoline-1,3(2H)-dione
  • 2-Amino-1H-benzo[de]isoquinoline-1,3(2H)-dione
Found 4 products.