CymitQuimica logo

CAS 56966-49-5

:

4-Chloro-2-(4-chlorophenoxy)benzenamine

Description:
4-Chloro-2-(4-chlorophenoxy)benzenamine, with the CAS number 56966-49-5, is an organic compound characterized by its aromatic structure, which includes a primary amine group and two chlorinated phenyl rings. This compound features a chloro substituent on both the benzene ring and the phenoxy group, contributing to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the amine group suggests that it can participate in nucleophilic reactions, while the chlorinated phenyl groups may enhance its biological activity or influence its solubility in organic solvents. The compound's molecular structure indicates it may exhibit specific interactions with biological targets, making it of interest for research in medicinal chemistry. Additionally, the chlorinated groups can affect the compound's stability and environmental persistence. Safety and handling precautions should be observed due to the potential toxicity associated with chlorinated aromatic compounds. Overall, 4-Chloro-2-(4-chlorophenoxy)benzenamine is a notable compound for its unique structural features and potential applications.
Formula:C12H9Cl2NO
InChI:InChI=1S/C12H9Cl2NO/c13-8-1-4-10(5-2-8)16-12-7-9(14)3-6-11(12)15/h1-7H,15H2
InChI key:InChIKey=HDGZIHCCEYFXMQ-UHFFFAOYSA-N
SMILES:O(C1=C(N)C=CC(Cl)=C1)C2=CC=C(Cl)C=C2
Synonyms:
  • Benzenamine, 4-chloro-2-(4-chlorophenoxy)-
  • 4-Chloro-2-(4-chlorophenoxy)benzenamine
  • 2′-Amino-4,4′-dichlorodiphenyl ether
Found 3 products.