CymitQuimica logo

CAS 570391-47-8

:

N-[1,1'-Biphenyl]-3-yl-[1,1'-biphenyl]-4-amine

Description:
N-[1,1'-Biphenyl]-3-yl-[1,1'-biphenyl]-4-amine, identified by its CAS number 570391-47-8, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features an amine functional group, specifically an aniline derivative, where the amine is substituted at the para position of one biphenyl moiety and at the meta position of another. The presence of multiple aromatic rings contributes to its potential for strong π-π stacking interactions, which can influence its physical properties, such as solubility and melting point. Additionally, the compound may exhibit interesting electronic properties due to the conjugated system formed by the biphenyl units, making it a candidate for applications in organic electronics, such as organic light-emitting diodes (OLEDs) or organic photovoltaics. Its synthesis and handling should be approached with standard safety precautions typical for organic compounds, particularly those containing amine groups, which can be reactive and may require careful storage and disposal.
Formula:C24H19N
InChI:InChI=1S/C24H19N/c1-3-8-19(9-4-1)21-14-16-23(17-15-21)25-24-13-7-12-22(18-24)20-10-5-2-6-11-20/h1-18,25H
InChI key:CSFNUYPFWSRMET-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C2=CC=C(C=C2)NC3=CC=CC(=C3)C4=CC=CC=C4
Found 5 products.