CymitQuimica logo

CAS 57056-57-2

:

ethyl (3R)-1-benzyl-4,5-dioxopyrrolidine-3-carboxylate

Description:
Ethyl (3R)-1-benzyl-4,5-dioxopyrrolidine-3-carboxylate, with the CAS number 57056-57-2, is a chemical compound characterized by its pyrrolidine ring structure, which features a dioxo substituent and a carboxylate group. This compound typically exhibits properties associated with both its ester and amine functionalities, making it a versatile intermediate in organic synthesis. The presence of the benzyl group contributes to its hydrophobic characteristics, while the ethyl ester enhances its solubility in organic solvents. The stereochemistry indicated by the (3R) designation suggests specific spatial arrangements that can influence the compound's reactivity and interaction with biological systems. Ethyl (3R)-1-benzyl-4,5-dioxopyrrolidine-3-carboxylate may be of interest in medicinal chemistry for its potential applications in drug development, particularly in the synthesis of biologically active molecules. As with many organic compounds, its stability, reactivity, and interactions can be influenced by environmental factors such as pH and temperature.
Formula:C14H15NO4
InChI:InChI=1/C14H15NO4/c1-2-19-14(18)11-9-15(13(17)12(11)16)8-10-6-4-3-5-7-10/h3-7,11H,2,8-9H2,1H3/t11-/m1/s1
SMILES:CCOC(=O)[C@@H]1CN(Cc2ccccc2)C(=O)C1=O
Found 2 products.