CymitQuimica logo

CAS 57056-80-1

:

N,N-dimethylcyclobutanecarboxamide

Description:
N,N-Dimethylcyclobutanecarboxamide is an organic compound characterized by its cyclic structure and amide functional group. It features a cyclobutane ring, which contributes to its unique three-dimensional conformation and potential strain effects. The presence of two methyl groups attached to the nitrogen atom of the amide enhances its steric properties and solubility in organic solvents. This compound is typically a colorless to pale yellow liquid at room temperature, with a relatively low boiling point compared to larger amides. Its molecular structure suggests it may exhibit polar characteristics due to the amide group, which can engage in hydrogen bonding. N,N-Dimethylcyclobutanecarboxamide may find applications in organic synthesis, as a solvent, or as an intermediate in the production of pharmaceuticals and agrochemicals. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, its unique structural features and functional groups make it a compound of interest in various chemical research and industrial applications.
Formula:C7H13NO
InChI:InChI=1/C7H13NO/c1-8(2)7(9)6-4-3-5-6/h6H,3-5H2,1-2H3
InChI key:KYJXFJJPTBJREV-UHFFFAOYSA-N
SMILES:CN(C)C(=O)C1CCC1
Found 2 products.