CAS 572-30-5: avicularin
Description:Avicularin, with the CAS number 572-30-5, is a flavonoid glycoside primarily derived from various plant sources, particularly those in the family of the genus *Euphorbia*. It is characterized by its chemical structure, which includes a flavone backbone with a sugar moiety, typically rhamnose. Avicularin exhibits a range of biological activities, including antioxidant, anti-inflammatory, and potential antimicrobial properties, making it of interest in pharmacological research. Its solubility is generally moderate in polar solvents, and it can be identified through various spectroscopic methods, including UV-Vis and NMR spectroscopy. The compound's potential health benefits are attributed to its ability to scavenge free radicals and modulate various biochemical pathways. Additionally, avicularin has been studied for its role in traditional medicine, particularly in herbal remedies. However, further research is necessary to fully elucidate its mechanisms of action and therapeutic potential.
Formula:C20H18O11
InChI:InChI=1S/C20H18O11/c21-6-13-15(26)17(28)20(30-13)31-19-16(27)14-11(25)4-8(22)5-12(14)29-18(19)7-1-2-9(23)10(24)3-7/h1-5,13,15,17,20-26,28H,6H2/t13-,15-,17+,20-/m0/s1
InChI key:InChIKey=BDCDNTVZSILEOY-UXYNSRGZSA-N
SMILES:O=C1C(OC2OC(CO)C(O)C2O)=C(OC=3C=C(O)C=C(O)C13)C=4C=CC(O)=C(O)C4
- Synonyms:
- 3-(α-<span class="text-smallcaps">L</span>-Arabinofuranosyloxy)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 3-(alpha-L-arabinofuranosyloxy)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-
- 4H-1-Benzopyran-4-one, 3-(α-<span class="text-smallcaps">L</span>-arabinofuranosyloxy)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-
- Avicularine
- Avicularoside
- Quercetin 3-O-α-<span class="text-smallcaps">L</span>-arabinofuranoside
- Quercetin 3-α-<span class="text-smallcaps">L</span>-arabinofuranoside
