CAS 5720-06-9
:2-Methoxyphenylboronic acid
Description:
2-Methoxyphenylboronic acid, with the CAS number 5720-06-9, is an organoboron compound characterized by the presence of a boronic acid functional group attached to a methoxy-substituted phenyl ring. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols due to the presence of the boronic acid group, which can form hydrogen bonds. It is known for its utility in organic synthesis, particularly in Suzuki-Miyaura cross-coupling reactions, where it serves as a versatile building block for the formation of carbon-carbon bonds. The methoxy group enhances its reactivity and solubility, making it a valuable reagent in medicinal chemistry and materials science. Additionally, 2-methoxyphenylboronic acid can participate in various chemical transformations, including the formation of boronate esters and coordination with metal catalysts. Its ability to form reversible complexes with diols also makes it useful in sensing applications. Overall, this compound is significant in both academic research and industrial applications due to its unique chemical properties.
Formula:C7H9BO3
InChI:InChI=1S/C7H9BO3/c1-11-7-5-3-2-4-6(7)8(9)10/h2-5,9-10H,1H3
InChI key:InChIKey=ROEQGIFOWRQYHD-UHFFFAOYSA-N
SMILES:O(C)C1=C(B(O)O)C=CC=C1
Synonyms:- (2-Methoxyphenyl)boric acid
- 2-Methoxyphenylboronic acid
- B-(2-Methoxyphenyl)boronic acid
- Benzeneboronic acid, o-methoxy-
- Boronic acid, (2-methoxyphenyl)-
- Boronic acid, B-(2-methoxyphenyl)-
- o-Anisylboronic acid
- o-Methoxybenzeneboronic acid
- o-Methoxyphenylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
2-Methoxybenzeneboronic acid, 97%
CAS:2-Methoxylphenylboronic acid is a phenylboronic acid used to investigate boron function in plants. It is used in Suzuki reaction, organic reaction that is classified as a coupling reaction where the coupling partners are a boronic acid with a halide catalyzed by a palladium(0) complex. This ThermoFormula:C7H9BO3Purity:97%Color and Shape:White to pale cream, Crystals or powder or crystalline powderMolecular weight:151.962-Methoxyphenylboronic acid, min. 97%
CAS:2-Methoxyphenylboronic acid, min. 97%
Formula:CH3OC6H4B(OH)2Purity:min. 97%Color and Shape:white to off-white pwdr.Molecular weight:151.962-Methoxyphenylboronic acid
CAS:Formula:C7H9BO3Purity:98%Color and Shape:SolidMolecular weight:151.9556Ref: IN-DA003HJR
1gTo inquire5g20.00€10g23.00€25g34.00€50g49.00€100g74.00€250g136.00€500g184.00€1kg320.00€5kg1,178.00€10kg2,266.00€2-Methoxybenzeneboronic acid
CAS:2-Methoxybenzeneboronic acidFormula:C7H9BO3Purity:≥95%Color and Shape:SolidMolecular weight:151.955562-Methoxyphenylboronic acid
CAS:Formula:C7H9BO3Purity:≥ 98.0%Color and Shape:Off-white powderMolecular weight:151.962-Methoxybenzeneboronic acid
CAS:Formula:C7H9BO3Purity:98%Color and Shape:Solid, Crystalline Powder or PowderMolecular weight:151.962-Methoxyphenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C7H9BO3Purity:97.0 to 113.0 %Color and Shape:White to Almost white powder to crystalMolecular weight:151.962-Methoxyphenylboronic acid
CAS:2-Methoxyphenylboronic acidFormula:C7H9BO3Purity:98%Molecular weight:151.962-Methoxyphenylboronic Acid extrapure, 95%
CAS:Formula:C7H9BO3Purity:min. 95%Color and Shape:White to off-white, Crystalline powderMolecular weight:157.002-Methoxylphenylboronic Acid (contains varying amounts of Anhydride)
CAS:Controlled ProductApplications 2-Methoxylphenylboronic Acid is a phenylboronic acid used to investigate boron function in plants.
References Baldwin, T., et al.: Plant Physiol., 103, 115 (1993), Andeme-Onzighi, C., et al.: Planta, 215, 949 (2002), Brown, P., et al.: Plant Biol. 4, 205 (2005),Formula:C7H9BO3Color and Shape:NeatMolecular weight:151.96









