CymitQuimica logo

CAS 57227-09-5

:

α-(Benzoylamino)-4-hydroxy-N,N-dipropylbenzenepropanamide

Description:
α-(Benzoylamino)-4-hydroxy-N,N-dipropylbenzenepropanamide, with the CAS number 57227-09-5, is a chemical compound characterized by its complex structure, which includes a benzoylamino group, a hydroxy group, and a dipropyl substituent on a propanamide backbone. This compound typically exhibits properties associated with amides, such as moderate solubility in organic solvents and potential hydrogen bonding due to the presence of the hydroxy group. The benzoylamino moiety contributes to its aromatic characteristics, which may influence its reactivity and interactions with other molecules. Additionally, the dipropyl groups can affect the compound's lipophilicity, potentially impacting its biological activity and pharmacokinetics. The presence of multiple functional groups suggests that this compound may participate in various chemical reactions, including acylation and hydrogen bonding, making it of interest in medicinal chemistry and material science. Its specific applications and behavior would depend on the context of its use, including potential roles in drug development or as a chemical intermediate.
Formula:C22H28N2O3
InChI:InChI=1S/C22H28N2O3/c1-3-14-24(15-4-2)22(27)20(16-17-10-12-19(25)13-11-17)23-21(26)18-8-6-5-7-9-18/h5-13,20,25H,3-4,14-16H2,1-2H3,(H,23,26)
InChI key:InChIKey=VIXHHPJUMYBSCY-UHFFFAOYSA-N
SMILES:C(C(N(CCC)CCC)=O)(CC1=CC=C(O)C=C1)NC(=O)C2=CC=CC=C2
Synonyms:
  • Benzenepropanamide, a-(benzoylamino)-4-hydroxy-N,N-dipropyl-
  • Cr 1936
  • N-Benzoyl-DL-tyrosil-di-n-propylamide
  • α-(Benzoylamino)-4-hydroxy-N,N-dipropylbenzenepropanamide
Found 5 products.